3-Nitro Benzoic Acid
Minimum Order: 0
Quality/Safety Certification: 0.00
3-Nitro Benzoic Acid
High Quality
Earliest Shipment
Competitive price
Professional Service
Product: 3-Nitro Benzoic Acid
High Quality
Earliest Shipment
Competitive price
Professional Service
3-Nitrobenzoic acid is an organic compound with the formula C6H4(NO2)CO2H. It is a precursor to 3-aminobenzoic acid, which is used to prepare some dyes.[2]
| IUPAC name[hide]3-nitrobenzoic acid | |
| Other names[hide]m-nitrobenzoic acid | |
| CAS number | 121-92-6 Y |
| PubChem | 8497 |
| ChemSpider | 8183 Y |
| ChEMBL | CHEMBL274839 Y |
| Jmol-3D images | Image 1 |
| [show]O=[N+]([O-])c1cc(C(=O)O)ccc1 | |
| [show]InChI=1S/C7H5NO4/c9-7(10)5-2-1-3-6(4-5)8(11)12/h1-4H,(H,9,10) Y Key: AFPHTEQTJZKQAQ-UHFFFAOYSA-N Y InChI=1/C7H5NO4/c9-7(10)5-2-1-3-6(4-5)8(11)12/h1-4H,(H,9,10) Key: AFPHTEQTJZKQAQ-UHFFFAOYAS | |
| Molecular formula | C7H5NO4 |
| Molar mass | 167.12 g/mol |
| Density | 1.494 |
| Melting point | 139-141 °C |
| Solubility in water | 0.24 g/100 mL (15 °C) |
| Acidity (pKa) | 3.47 (in water)[1] |
| Related compounds | Benzoic acid Nitrobenzene Anthranilic acid 3,5-Dinitrobenzoic acid 2-Nitrobenzoic acid 4-Nitrobenzoic acid |
