2-Naphthol
High Quality
Earliest Shipment
Competitive price
Professional Service
Product:2-Naphthol
High Quality
Earliest Shipment
Competitive price
Professional Service
2-Naphthol, or β-naphthol, is a colorless crystalline solid with the formula C10H7OH. It is an isomer of 1-naphthol, differing by the location of the hydroxyl group on naphthalene. The naphthols are naphthalene homologues of phenol, with the hydroxyl group being more reactive than in the phenols. Both isomers are soluble in simple alcohols, ethers, and chloroform. They can be used in the production of dyes and in organic synthesis. For example, 2-naphthol reacts to form BINOL.
| IUPAC name[hide]Naphthalen-2-ol | |
| Other names[hide]2-Hydroxynaphthalene; 2-Naphthalenol; beta-Naphthol | |
| CAS number | 135-19-3 Y |
| PubChem | 8663 |
| ChemSpider | 8341 Y |
| UNII | P2Z71CIK5H Y |
| KEGG | C11713 Y |
| ChEBI | CHEBI:10432 Y |
| ChEMBL | CHEMBL14126 Y |
| Jmol-3D images | Image 1 Image 2 |
| [show]Oc2ccc1c(cccc1)c2 c1ccc2cc(ccc2c1)O | |
| [show]InChI=1S/C10H8O/c11-10-6-5-8-3-1-2-4-9(8)7-10/h1-7,11H Y Key: JWAZRIHNYRIHIV-UHFFFAOYSA-N Y InChI=1/C10H8O/c11-10-6-5-8-3-1-2-4-9(8)7-10/h1-7,11H Key: JWAZRIHNYRIHIV-UHFFFAOYAV | |
| Molecular formula | C10H8O |
| Molar mass | 144.17 g mol−1 |
| Appearance | Colorless crystalline solid |
| Density | 1.217 g/cm3 |
| Melting point | 123 °C, 396 K, 253 °F |
| Boiling point | 285 °C, 558 K, 545 °F |
| Solubility in water | 0.74 g/L |
| Acidity (pKa) | 9.51 |
| R-phrases | R20 R22 R50 |
| S-phrases | S24 S25 S61 |
| Main hazards | Harmful when inhaled or swallowed; dangerous to environment, esp. aquatic organisms.[1] |
